CAS 1138443-86-3
:5-Bromo-2-(dimethoxymethyl)-3-methoxypyridine
Description:
5-Bromo-2-(dimethoxymethyl)-3-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of bromine at the 5-position introduces a halogen substituent, enhancing the compound's reactivity and potential applications in synthesis. The dimethoxymethyl group at the 2-position contributes to the compound's solubility and may influence its electronic properties, while the methoxy group at the 3-position can affect its steric and electronic characteristics. This compound is likely to exhibit moderate polarity due to the presence of multiple methoxy groups, which can engage in hydrogen bonding. Its unique structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's reactivity can be leveraged in various organic synthesis pathways, making it a valuable intermediate in chemical research. Safety and handling precautions should be observed due to the presence of bromine, which can pose health risks.
Formula:C9H12BrNO3
InChI:InChI=1S/C9H12BrNO3/c1-12-7-4-6(10)5-11-8(7)9(13-2)14-3/h4-5,9H,1-3H3
InChI key:InChIKey=YOIJJDCAWUXHRJ-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=C(OC)C=C(Br)C=N1
Synonyms:- Pyridine, 5-bromo-2-(dimethoxymethyl)-3-methoxy-
- 5-Bromo-2-(dimethoxymethyl)-3-methoxypyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
