CymitQuimica logo

CAS 1138443-87-4

:

6-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2,3-dimethoxypyridine

Description:
6-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2,3-dimethoxypyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with methoxy groups and a silyl ether moiety. The presence of the dimethylethyl group contributes to its hydrophobic properties, while the methoxy groups enhance its solubility in organic solvents. This compound is likely to exhibit moderate to low volatility due to the bulky silyl group, which can also influence its reactivity and stability. The pyridine ring suggests potential applications in coordination chemistry and as a ligand in metal complexes. Additionally, the presence of the silyl ether may provide protective characteristics, making it useful in organic synthesis and as an intermediate in the production of more complex molecules. Overall, this compound's unique structural features may lead to interesting biological or chemical properties, warranting further investigation for potential applications in pharmaceuticals or materials science.
Formula:C14H25NO3Si
InChI:InChI=1S/C14H25NO3Si/c1-14(2,3)19(6,7)18-10-11-8-9-12(16-4)13(15-11)17-5/h8-9H,10H2,1-7H3
InChI key:InChIKey=ANUDVRIMTVJPLR-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C=1N=C(OC)C(OC)=CC1
Synonyms:
  • 6-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2,3-dimethoxypyridine
  • Pyridine, 6-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-2,3-dimethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.