CAS 1138443-91-0
:3-(Dimethoxymethyl)-5-methoxy-4-(trimethylsilyl)pyridine
Description:
3-(Dimethoxymethyl)-5-methoxy-4-(trimethylsilyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of multiple methoxy groups (–OCH3) and a trimethylsilyl group (–Si(CH3)3) contributes to its unique chemical properties, enhancing its solubility and reactivity. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of the methoxy and silyl substituents on biological activity. The trimethylsilyl group can also provide protection for reactive functional groups during synthetic transformations. Overall, the compound's characteristics, including its molecular stability and reactivity, make it a valuable substance in various chemical applications.
Formula:C12H21NO3Si
InChI:InChI=1S/C12H21NO3Si/c1-14-10-8-13-7-9(12(15-2)16-3)11(10)17(4,5)6/h7-8,12H,1-6H3
InChI key:InChIKey=GDXMJVFGSOEQDV-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C=1C(C(OC)OC)=CN=CC1OC
Synonyms:- 3-(Dimethoxymethyl)-5-methoxy-4-(trimethylsilyl)pyridine
- Pyridine, 3-(dimethoxymethyl)-5-methoxy-4-(trimethylsilyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.