CAS 1138443-93-2
:5,6-Dimethoxy-3-pyridinecarboxaldehyde oxime
Description:
5,6-Dimethoxy-3-pyridinecarboxaldehyde oxime is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of two methoxy groups (-OCH3) at the 5 and 6 positions of the pyridine ring contributes to its chemical properties, enhancing its solubility in organic solvents and potentially influencing its reactivity. The oxime functional group (-C=N-OH) is derived from the reaction of the aldehyde group with hydroxylamine, which can impart specific reactivity, particularly in condensation reactions and as a potential ligand in coordination chemistry. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including organic synthesis and material science. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH, temperature, and the presence of catalysts.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-12-7-3-6(5-10-11)4-9-8(7)13-2/h3-5,11H,1-2H3
InChI key:InChIKey=XDPKWZVQQZZGSX-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)N=CC(C=NO)=C1
Synonyms:- 5,6-Dimethoxy-3-pyridinecarboxaldehyde oxime
- 3-Pyridinecarboxaldehyde, 5,6-dimethoxy-, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
