CymitQuimica logo

CAS 1138443-95-4

:

5,6-Dimethoxy-2-pyridinecarboxaldehyde oxime

Description:
5,6-Dimethoxy-2-pyridinecarboxaldehyde oxime is an organic compound characterized by its oxime functional group, which is derived from the corresponding aldehyde. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with two methoxy groups at the 5 and 6 positions, enhancing its solubility and reactivity. The presence of the oxime group indicates that it can participate in various chemical reactions, such as condensation and rearrangement, making it useful in synthetic organic chemistry. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where pyridine derivatives are often explored for their biological activity. Additionally, the methoxy groups may influence the electronic properties of the molecule, affecting its reactivity and interaction with biological targets. Overall, 5,6-Dimethoxy-2-pyridinecarboxaldehyde oxime is a versatile compound with interesting chemical properties that warrant further investigation for potential applications in various fields.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-12-7-4-3-6(5-9-11)10-8(7)13-2/h3-5,11H,1-2H3
InChI key:InChIKey=FGIMNFLPYRRIJH-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(C=NO)=N1
Synonyms:
  • 5,6-Dimethoxy-2-pyridinecarboxaldehyde oxime
  • 2-Pyridinecarboxaldehyde, 5,6-dimethoxy-, oxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.