CAS 1138444-11-7: 5-Methoxy-4-(trimethylsilyl)-3-pyridinecarbonitrile

Description: 5-Methoxy-4-(trimethylsilyl)-3-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 5-position and a trimethylsilyl group (-(Si(CH3)3) at the 4-position contributes to its unique chemical properties, enhancing its solubility and stability. The cyano group (-C≡N) at the 3-position introduces a polar functional group, which can participate in various chemical reactions, including nucleophilic additions and coordination with metal ions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a versatile building block. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the trimethylsilyl group can serve as a protecting group in synthetic pathways, facilitating the selective functionalization of other reactive sites within the molecule.

Formula: C₁₀H₁₄N₂OSi

InChI: InChI=1S/C10H14N2OSi/c1-13-9-7-12-6-8(5-11)10(9)14(2,3)4/h6-7H,1-4H3

InChI key: InChIKey=ZCNLVKRBBKJZFI-UHFFFAOYSA-N

SMILES: N#CC1=CN=CC(OC)=C1[Si](C)(C)C

Synonyms:

• 3-Pyridinecarbonitrile, 5-methoxy-4-(trimethylsilyl)-
• 5-Methoxy-4-(trimethylsilyl)-3-pyridinecarbonitrile

5-Methoxy-4-(trimethylsilyl)nicotinonitrile

CAS: 1138444-11-7

• Purity: 95+%
• Molecular weight: 206.32000732421875

5-Methoxy-4-(trimethylsilyl)nicotinonitrile

CAS: 1138444-11-7

Versatile small molecule scaffold

• Formula: C₁₀H₁₄N₂OSi
• Purity: Min. 95%
• Molecular weight: 206.32 g/mol