CAS 1138444-25-3
:Methyl 3-(5,6-dimethoxy-2-pyridinyl)-2-propenoate
Description:
Methyl 3-(5,6-dimethoxy-2-pyridinyl)-2-propenoate is an organic compound characterized by its unique structure, which includes a methoxy-substituted pyridine ring and an α,β-unsaturated ester functional group. This compound typically exhibits properties associated with both the pyridine and ester functionalities, such as moderate polarity and potential reactivity in various chemical reactions, including nucleophilic additions and Michael additions. The presence of methoxy groups enhances its solubility in organic solvents and may influence its biological activity. Methyl 3-(5,6-dimethoxy-2-pyridinyl)-2-propenoate may also demonstrate interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a valuable building block in organic synthesis and may have applications in drug development or as a research tool in chemical biology.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c1-14-9-6-4-8(12-11(9)16-3)5-7-10(13)15-2/h4-7H,1-3H3
InChI key:InChIKey=CCEYCRIDTIMCDW-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(C=CC(OC)=O)=N1
Synonyms:- Methyl 3-(5,6-dimethoxy-2-pyridinyl)-2-propenoate
- 2-Propenoic acid, 3-(5,6-dimethoxy-2-pyridinyl)-, methyl ester
- Methyl 3-(5,6-dimethoxypyridin-2-yl)acrylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.