CAS 1138444-26-4
:N-(2-Chloro-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(2-Chloro-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with chlorine and iodine atoms, as well as a branched amide functional group. The presence of the halogen substituents (chlorine and iodine) on the pyridine ring can influence the compound's reactivity, polarity, and biological activity. The 2,2-dimethylpropanamide moiety contributes to the steric bulk and may affect the compound's solubility and interaction with biological targets. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application. Overall, the unique combination of functional groups and substituents in this compound provides a basis for its potential utility in research and industry.
Formula:C10H12ClIN2O
InChI:InChI=1S/C10H12ClIN2O/c1-10(2,3)9(15)13-6-4-5-7(12)14-8(6)11/h4-5H,1-3H3,(H,13,15)
InChI key:InChIKey=QXSGQKGYTRBNNT-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(Cl)N=C(I)C=C1
Synonyms:- Propanamide, N-(2-chloro-6-iodo-3-pyridinyl)-2,2-dimethyl-
- N-(2-Chloro-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.