CAS 1138444-30-0

2,5-Diiodo-3-pyridinyl 1,1-dimethylethyl carbonate

Description:

2,5-Diiodo-3-pyridinyl 1,1-dimethylethyl carbonate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with two iodine atoms at the 2 and 5 positions, and a tert-butyl carbonate group. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the polar carbonate functional group. The iodine substituents can enhance the compound's reactivity and influence its electronic properties, making it of interest in various chemical applications, including medicinal chemistry and material science. The tert-butyl carbonate moiety can provide stability and may also serve as a leaving group in nucleophilic substitution reactions. Additionally, the compound's potential biological activity could be explored in pharmaceutical research, particularly in the development of new therapeutic agents. As with many halogenated compounds, safety precautions should be taken due to the potential toxicity associated with iodine and the overall reactivity of the molecule.

Formula: C₁₀H₁₁I₂NO₃

InChI: InChI=1S/C10H11I2NO3/c1-10(2,3)16-9(14)15-7-4-6(11)5-13-8(7)12/h4-5H,1-3H3

InChI key: InChIKey=WMVJULQDZSDXLS-UHFFFAOYSA-N

SMILES: O(C(OC(C)(C)C)=O)C1=C(I)N=CC(I)=C1

Synonyms:

• 2,5-Diiodo-3-pyridinyl 1,1-dimethylethyl carbonate
• Carbonic acid, 2,5-diiodo-3-pyridinyl 1,1-dimethylethyl ester