
CAS 1138444-82-2
:1-(1,1-Difluoroethyl)-2-(phenylmethoxy)benzene
Description:
1-(1,1-Difluoroethyl)-2-(phenylmethoxy)benzene, identified by its CAS number 1138444-82-2, is an organic compound characterized by its unique molecular structure, which includes a difluoroethyl group and a phenylmethoxy substituent. This compound typically exhibits properties associated with aromatic compounds, such as a relatively high boiling point and moderate solubility in organic solvents. The presence of the difluoroethyl group introduces fluorine atoms, which can enhance the compound's lipophilicity and influence its reactivity, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The phenylmethoxy group contributes to the compound's stability and can affect its electronic properties, potentially impacting its interactions with biological targets. Overall, the combination of these functional groups suggests that this compound may exhibit interesting chemical behavior and biological activity, warranting further investigation in synthetic and medicinal chemistry contexts.
Formula:C15H14F2O
InChI:InChI=1S/C15H14F2O/c1-15(16,17)13-9-5-6-10-14(13)18-11-12-7-3-2-4-8-12/h2-10H,11H2,1H3
InChI key:InChIKey=RYNDVZOGRMAMSP-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=C(OCC2=CC=CC=C2)C=CC=C1
Synonyms:- 1-(1,1-Difluoroethyl)-2-(phenylmethoxy)benzene
- Benzene, 1-(1,1-difluoroethyl)-2-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.