CAS 1138444-87-7

1-Chloro-3-(1,1-difluoroethyl)-2,4-difluorobenzene

Description:

1-Chloro-3-(1,1-difluoroethyl)-2,4-difluorobenzene is an organic compound characterized by its chlorinated and fluorinated aromatic structure. It features a benzene ring substituted with a chlorine atom and multiple fluorine atoms, which significantly influence its chemical properties. The presence of the difluoroethyl group introduces additional reactivity and polarity to the molecule. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. Its fluorinated nature contributes to high thermal stability and low volatility, making it useful in various applications, including as an intermediate in the synthesis of agrochemicals and pharmaceuticals. The compound's unique structure also suggests potential uses in materials science, particularly in the development of fluorinated polymers. However, due to the presence of chlorine and fluorine, it may exhibit environmental persistence and bioaccumulation potential, necessitating careful handling and assessment of its ecological impact. Safety data sheets should be consulted for specific handling and exposure guidelines.

Formula: C₈H₅ClF₄

InChI: InChI=1S/C8H5ClF4/c1-8(12,13)6-5(10)3-2-4(9)7(6)11/h2-3H,1H3

InChI key: InChIKey=ADRKRNUFDDYXGA-UHFFFAOYSA-N

SMILES: C(C)(F)(F)C1=C(F)C(Cl)=CC=C1F

Synonyms:

• 1-Chloro-3-(1,1-difluoroethyl)-2,4-difluorobenzene
• Benzene, 1-chloro-3-(1,1-difluoroethyl)-2,4-difluoro-