CAS 1138444-88-8

1-Chloro-2-(1,1-difluoroethyl)-4,5-difluorobenzene

Description:

1-Chloro-2-(1,1-difluoroethyl)-4,5-difluorobenzene is an organic compound characterized by its chlorinated and fluorinated aromatic structure. It features a benzene ring substituted with a chlorine atom and two fluorine atoms at the 4 and 5 positions, along with a 1,1-difluoroethyl group at the 2 position. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its molecular structure contributes to its chemical stability and reactivity, making it of interest in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of multiple electronegative fluorine and chlorine atoms influences its physical properties, such as boiling point, solubility, and polarity. Additionally, the compound's environmental and health impacts should be considered, as halogenated compounds can exhibit toxicity and persistence in the environment. Proper handling and safety measures are essential when working with this substance in laboratory or industrial settings.

Formula: C₈H₅ClF₄

InChI: InChI=1S/C8H5ClF4/c1-8(12,13)4-2-6(10)7(11)3-5(4)9/h2-3H,1H3

InChI key: InChIKey=HTMMJPLXJLZKRK-UHFFFAOYSA-N

SMILES: C(C)(F)(F)C1=C(Cl)C=C(F)C(F)=C1

Synonyms:

• 1-Chloro-2-(1,1-difluoroethyl)-4,5-difluorobenzene
• Benzene, 1-chloro-2-(1,1-difluoroethyl)-4,5-difluoro-