CAS 1138445-00-7

1,4-Dichloro-2-(difluorophenylmethyl)benzene

Description:

1,4-Dichloro-2-(difluorophenylmethyl)benzene, with the CAS number 1138445-00-7, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms and a difluorophenylmethyl group. This compound typically exhibits a high degree of hydrophobicity due to the presence of multiple halogen substituents, which can influence its solubility in organic solvents while rendering it less soluble in water. The dichloro and difluoromethyl groups contribute to its potential reactivity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its molecular structure suggests that it may possess significant electronic effects, which can affect its chemical behavior, such as reactivity and interaction with biological systems. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 1,4-Dichloro-2-(difluorophenylmethyl)benzene is a compound of interest in both industrial and research settings due to its unique properties and potential applications.

Formula: C₁₃H₈Cl₂F₂

InChI: InChI=1S/C13H8Cl2F2/c14-10-6-7-12(15)11(8-10)13(16,17)9-4-2-1-3-5-9/h1-8H

InChI key: InChIKey=HBOQAJVHNVMPJM-UHFFFAOYSA-N

SMILES: C(F)(F)(C1=C(Cl)C=CC(Cl)=C1)C2=CC=CC=C2

Synonyms:

• 1,4-Dichloro-2-(difluorophenylmethyl)benzene
• Benzene, 1,4-dichloro-2-(difluorophenylmethyl)-