CymitQuimica logo

CAS 1138445-10-9

:

1-(1,1-Difluoroethyl)-3,5-difluorobenzene

Description:
1-(1,1-Difluoroethyl)-3,5-difluorobenzene is an organic compound characterized by its unique structure, which includes a difluoroethyl group attached to a benzene ring that has two additional fluorine substituents at the 3 and 5 positions. This compound is part of the class of fluorinated aromatic compounds, known for their stability and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of multiple fluorine atoms enhances its lipophilicity and can influence its reactivity and interaction with biological systems. Typically, such compounds exhibit low volatility and high thermal stability, making them suitable for specific industrial applications. Additionally, the fluorine substituents can impart unique electronic properties, affecting the compound's behavior in chemical reactions. Safety data sheets would provide essential information regarding its handling, storage, and potential hazards, as fluorinated compounds can sometimes pose environmental and health risks. Overall, 1-(1,1-Difluoroethyl)-3,5-difluorobenzene exemplifies the diverse chemistry of fluorinated organic compounds.
Formula:C8H6F4
InChI:InChI=1S/C8H6F4/c1-8(11,12)5-2-6(9)4-7(10)3-5/h2-4H,1H3
InChI key:InChIKey=SBCKDBDOFDSZFH-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=CC(F)=CC(F)=C1
Synonyms:
  • Benzene, 1-(1,1-difluoroethyl)-3,5-difluoro-
  • 1-(1,1-Difluoroethyl)-3,5-difluorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.