
CAS 1138445-11-0
:1-(1,1-Difluoroethyl)-3-ethoxybenzene
Description:
1-(1,1-Difluoroethyl)-3-ethoxybenzene, identified by its CAS number 1138445-11-0, is an organic compound characterized by the presence of a difluoroethyl group and an ethoxy substituent on a benzene ring. This compound features a benzene core, which is a stable aromatic structure, contributing to its chemical stability and potential reactivity. The difluoroethyl group introduces fluorine atoms, which can enhance the compound's lipophilicity and influence its interaction with biological systems, making it of interest in medicinal chemistry and agrochemical applications. The ethoxy group adds to the compound's solubility properties, potentially allowing for better dissolution in organic solvents. The presence of both fluorine and ethoxy functionalities suggests that this compound may exhibit unique electronic properties and reactivity patterns, which could be exploited in various chemical reactions or applications. Overall, 1-(1,1-Difluoroethyl)-3-ethoxybenzene represents a versatile structure with potential utility in synthetic chemistry and material science.
Formula:C10H12F2O
InChI:InChI=1S/C10H12F2O/c1-3-13-9-6-4-5-8(7-9)10(2,11)12/h4-7H,3H2,1-2H3
InChI key:InChIKey=QQRXDPGAFZULAW-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=CC(OCC)=CC=C1
Synonyms:- Benzene, 1-(1,1-difluoroethyl)-3-ethoxy-
- 1-(1,1-Difluoroethyl)-3-ethoxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.