CymitQuimica logo

CAS 1138445-24-5

:

2-(1,1-Difluoroethyl)-1-fluoro-3-(trifluoromethyl)benzene

Description:
2-(1,1-Difluoroethyl)-1-fluoro-3-(trifluoromethyl)benzene, with the CAS number 1138445-24-5, is a fluorinated aromatic compound characterized by the presence of multiple fluorine substituents on its benzene ring. This compound features a difluoroethyl group attached to the benzene, which contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. The presence of the trifluoromethyl group enhances its electron-withdrawing characteristics, influencing its reactivity and stability. Such fluorinated compounds are often studied for their applications in pharmaceuticals, agrochemicals, and materials science due to their distinctive physical and chemical properties, such as high thermal stability and resistance to degradation. Additionally, the presence of multiple fluorine atoms can affect the compound's solubility and volatility, making it of interest in various chemical processes. Overall, 2-(1,1-Difluoroethyl)-1-fluoro-3-(trifluoromethyl)benzene exemplifies the unique behavior of fluorinated organic compounds in both synthetic and applied chemistry contexts.
Formula:C9H6F6
InChI:InChI=1S/C9H6F6/c1-8(11,12)7-5(9(13,14)15)3-2-4-6(7)10/h2-4H,1H3
InChI key:InChIKey=MFIPTYOZLIFZFD-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=C(C(F)(F)F)C=CC=C1F
Synonyms:
  • 2-(1,1-Difluoroethyl)-1-fluoro-3-(trifluoromethyl)benzene
  • Benzene, 2-(1,1-difluoroethyl)-1-fluoro-3-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.