CymitQuimica logo

CAS 1138445-26-7

:

2-(1,1-Difluoroethyl)-1,3,4-trifluorobenzene

Description:
2-(1,1-Difluoroethyl)-1,3,4-trifluorobenzene is a fluorinated organic compound characterized by its unique structure, which includes a trifluorobenzene ring and a difluoroethyl substituent. This compound is notable for its high degree of fluorination, which imparts distinct physical and chemical properties, such as increased stability, lower reactivity, and enhanced lipophilicity. The presence of multiple fluorine atoms can also influence its boiling and melting points, making it less volatile compared to non-fluorinated analogs. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atoms, potentially affecting its behavior in various chemical reactions. Its applications may span across fields such as materials science, pharmaceuticals, and agrochemicals, where fluorinated compounds are often sought for their unique characteristics. Safety data and handling precautions should be considered, as fluorinated compounds can pose environmental and health risks.
Formula:C8H5F5
InChI:InChI=1S/C8H5F5/c1-8(12,13)6-4(9)2-3-5(10)7(6)11/h2-3H,1H3
InChI key:InChIKey=UPYWZWWKWDATNZ-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=C(F)C(F)=CC=C1F
Synonyms:
  • 2-(1,1-Difluoroethyl)-1,3,4-trifluorobenzene
  • Benzene, 2-(1,1-difluoroethyl)-1,3,4-trifluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.