
CAS 1138445-28-9
:1-(1,1-Difluoroethyl)-2,4,5-trifluorobenzene
Description:
1-(1,1-Difluoroethyl)-2,4,5-trifluorobenzene is a fluorinated organic compound characterized by its unique structure, which includes a trifluorobenzene ring and a difluoroethyl substituent. The presence of multiple fluorine atoms contributes to its chemical stability and hydrophobic nature, making it less reactive compared to non-fluorinated analogs. This compound is likely to exhibit low volatility and high thermal stability, which are common traits of fluorinated compounds. Its molecular structure suggests potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science, particularly in the development of specialty chemicals or intermediates. Additionally, the fluorine atoms can influence the compound's electronic properties, potentially enhancing its performance in specific applications. Safety data sheets would typically indicate that handling should be done with care due to the potential toxicity and environmental impact of fluorinated compounds. Overall, 1-(1,1-Difluoroethyl)-2,4,5-trifluorobenzene represents a specialized chemical with distinct characteristics driven by its fluorinated nature.
Formula:C8H5F5
InChI:InChI=1S/C8H5F5/c1-8(12,13)4-2-6(10)7(11)3-5(4)9/h2-3H,1H3
InChI key:InChIKey=NMFBJPHGESOGSA-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=C(F)C=C(F)C(F)=C1
Synonyms:- 1-(1,1-Difluoroethyl)-2,4,5-trifluorobenzene
- Benzene, 1-(1,1-difluoroethyl)-2,4,5-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.