CAS 1138445-29-0
:1-(1,1-Difluoroethyl)-2-(trifluoromethyl)benzene
Description:
1-(1,1-Difluoroethyl)-2-(trifluoromethyl)benzene, identified by its CAS number 1138445-29-0, is an organic compound characterized by the presence of a benzene ring substituted with both a difluoroethyl group and a trifluoromethyl group. The difluoroethyl group introduces two fluorine atoms attached to a carbon that is also connected to another carbon, while the trifluoromethyl group consists of a carbon atom bonded to three fluorine atoms. This compound is likely to exhibit significant hydrophobicity due to the presence of multiple fluorine atoms, which can influence its solubility and volatility. The fluorinated groups can also impart unique electronic properties, potentially affecting reactivity and stability. Additionally, the presence of these fluorinated substituents may enhance the compound's resistance to degradation and alter its interaction with biological systems, making it of interest in various applications, including pharmaceuticals and agrochemicals. Safety and handling considerations are important due to the potential toxicity associated with fluorinated compounds.
Formula:C9H7F5
InChI:InChI=1S/C9H7F5/c1-8(10,11)6-4-2-3-5-7(6)9(12,13)14/h2-5H,1H3
InChI key:InChIKey=BDNFFEDUKSTDLI-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=C(C(F)(F)F)C=CC=C1
Synonyms:- 1-(1,1-Difluoroethyl)-2-(trifluoromethyl)benzene
- Benzene, 1-(1,1-difluoroethyl)-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
