CAS 1138445-43-8

4-(1,1-Difluoropropyl)-1,2-difluorobenzene

Description:

4-(1,1-Difluoropropyl)-1,2-difluorobenzene is an organic compound characterized by its unique structure, which includes a difluoropropyl group attached to a difluorobenzene ring. This compound features a benzene ring substituted at the 1 and 2 positions with fluorine atoms, contributing to its chemical stability and potential reactivity. The presence of the difluoropropyl group introduces additional steric and electronic effects, which can influence its physical and chemical properties, such as boiling point, solubility, and reactivity. Generally, compounds with multiple fluorine substituents exhibit increased lipophilicity and may have applications in various fields, including pharmaceuticals and agrochemicals. The fluorine atoms can enhance the compound's resistance to degradation and alter its interaction with biological systems. As with many fluorinated compounds, safety and environmental considerations are important, as they may exhibit unique toxicological profiles. Overall, 4-(1,1-Difluoropropyl)-1,2-difluorobenzene represents a class of compounds with significant potential for research and application in advanced materials and chemical synthesis.

Formula: C₉H₈F₄

InChI: InChI=1S/C9H8F4/c1-2-9(12,13)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3

InChI key: InChIKey=NPNATBKCOMMLGC-UHFFFAOYSA-N

SMILES: C(CC)(F)(F)C1=CC(F)=C(F)C=C1

Synonyms:

• Benzene, 4-(1,1-difluoropropyl)-1,2-difluoro-
• 4-(1,1-Difluoropropyl)-1,2-difluorobenzene