CymitQuimica logo

CAS 1138445-45-0

:

1-(1,1-Difluoropropyl)-2,3-difluorobenzene

Description:
1-(1,1-Difluoropropyl)-2,3-difluorobenzene is an organic compound characterized by its unique structure, which includes a difluoropropyl group attached to a difluorobenzene ring. This compound features a total of five fluorine atoms, which significantly influence its chemical properties, including increased electronegativity and potential reactivity. The presence of fluorine atoms typically enhances the compound's stability and lipophilicity, making it of interest in various applications, including pharmaceuticals and agrochemicals. The difluoropropyl group contributes to the compound's hydrophobic characteristics, while the difluorobenzene moiety may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine substituents. Additionally, the compound's molecular structure suggests potential for specific interactions in biological systems, which could be explored in drug design or material science. Overall, 1-(1,1-Difluoropropyl)-2,3-difluorobenzene represents a complex chemical entity with properties that merit further investigation in both synthetic and applied chemistry contexts.
Formula:C9H8F4
InChI:InChI=1S/C9H8F4/c1-2-9(12,13)6-4-3-5-7(10)8(6)11/h3-5H,2H2,1H3
InChI key:InChIKey=YVQBTNUAZFGZQQ-UHFFFAOYSA-N
SMILES:C(CC)(F)(F)C1=C(F)C(F)=CC=C1
Synonyms:
  • 1-(1,1-Difluoropropyl)-2,3-difluorobenzene
  • Benzene, 1-(1,1-difluoropropyl)-2,3-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.