CAS 1138445-46-1

1-(1,1-Difluoropropyl)-3,5-difluorobenzene

Description:

1-(1,1-Difluoropropyl)-3,5-difluorobenzene is an organic compound characterized by its unique structure, which includes a difluoropropyl group attached to a benzene ring that has two additional fluorine substituents at the 3 and 5 positions. This compound is likely to exhibit properties typical of fluorinated organic compounds, such as increased stability and altered reactivity due to the presence of fluorine atoms, which can influence both electronic and steric characteristics. The difluoropropyl group may impart hydrophobic properties, while the fluorine atoms on the benzene ring can enhance lipophilicity and potentially affect the compound's interaction with biological systems. Additionally, the presence of multiple fluorine atoms can lead to unique physical properties, such as higher boiling and melting points compared to their non-fluorinated counterparts. The compound's applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often valued for their distinctive chemical behavior and stability.

Formula: C₉H₈F₄

InChI: InChI=1S/C9H8F4/c1-2-9(12,13)6-3-7(10)5-8(11)4-6/h3-5H,2H2,1H3

InChI key: InChIKey=GTTINMBFUKEDJS-UHFFFAOYSA-N

SMILES: C(CC)(F)(F)C1=CC(F)=CC(F)=C1

Synonyms:

• Benzene, 1-(1,1-difluoropropyl)-3,5-difluoro-
• 1-(1,1-Difluoropropyl)-3,5-difluorobenzene