CymitQuimica logo

CAS 1138445-48-3

:

1-(1,1-Difluoropropyl)-2-fluoro-3-(trifluoromethyl)benzene

Description:
1-(1,1-Difluoropropyl)-2-fluoro-3-(trifluoromethyl)benzene, identified by its CAS number 1138445-48-3, is an organic compound characterized by its unique fluorinated structure. This compound features a benzene ring substituted with a trifluoromethyl group and a fluoro group, alongside a propyl chain that is difluorinated. The presence of multiple fluorine atoms contributes to its chemical stability and lipophilicity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The fluorinated groups can enhance the compound's reactivity and influence its physical properties, such as boiling and melting points, solubility, and volatility. Additionally, the compound's structure may impart specific biological activities, which could be of interest in medicinal chemistry. However, detailed studies on its toxicity, environmental impact, and specific reactivity would be necessary to fully understand its characteristics and potential applications. Overall, this compound exemplifies the significance of fluorinated organic molecules in modern chemistry.
Formula:C10H8F6
InChI:InChI=1S/C10H8F6/c1-2-9(12,13)6-4-3-5-7(8(6)11)10(14,15)16/h3-5H,2H2,1H3
InChI key:InChIKey=ZCYKHGOKJJPQJC-UHFFFAOYSA-N
SMILES:C(CC)(F)(F)C1=C(F)C(C(F)(F)F)=CC=C1
Synonyms:
  • 1-(1,1-Difluoropropyl)-2-fluoro-3-(trifluoromethyl)benzene
  • Benzene, 1-(1,1-difluoropropyl)-2-fluoro-3-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.