CAS 1138445-50-7

1-(2,2-Difluoropropyl)-4-methylbenzene

Description:

1-(2,2-Difluoropropyl)-4-methylbenzene, also known by its CAS number 1138445-50-7, is an organic compound characterized by a benzene ring substituted with a 4-methyl group and a 2,2-difluoropropyl group. This compound features a hydrophobic aromatic system due to the benzene ring, which contributes to its potential applications in various chemical processes and materials. The presence of the difluoropropyl group introduces unique electronic and steric properties, which can influence its reactivity and interactions with other molecules. The fluorine atoms enhance the compound's lipophilicity and may affect its boiling and melting points, as well as its solubility in different solvents. Additionally, the compound's structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific physical and chemical properties such as boiling point, melting point, and solubility would need to be determined through experimental methods or detailed literature for precise applications and handling guidelines.

Formula: C₁₀H₁₂F₂

InChI: InChI=1S/C10H12F2/c1-8-3-5-9(6-4-8)7-10(2,11)12/h3-6H,7H2,1-2H3

InChI key: InChIKey=RRVKGZQWHWOJNC-UHFFFAOYSA-N

SMILES: C(C(C)(F)F)C1=CC=C(C)C=C1

Synonyms:

• Benzene, 1-(2,2-difluoropropyl)-4-methyl-
• 1-(2,2-Difluoropropyl)-4-methylbenzene