CymitQuimica logo

CAS 1138445-53-0

:

5-(1,1-Difluoropropyl)-1,2,3-trifluorobenzene

Description:
5-(1,1-Difluoropropyl)-1,2,3-trifluorobenzene is a fluorinated organic compound characterized by its unique structure, which includes a trifluorobenzene ring substituted with a 1,1-difluoropropyl group. This compound exhibits significant fluorine content, which often imparts distinctive properties such as increased lipophilicity, thermal stability, and potential bioactivity. The presence of multiple fluorine atoms can enhance the compound's resistance to metabolic degradation, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the trifluorobenzene moiety contributes to its aromatic character, which may influence its reactivity and interactions with other chemical species. The compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by its fluorinated structure, typically resulting in lower volatility compared to non-fluorinated analogs. Overall, 5-(1,1-Difluoropropyl)-1,2,3-trifluorobenzene represents a class of compounds that are valuable in research and industrial applications due to their unique chemical characteristics.
Formula:C9H7F5
InChI:InChI=1S/C9H7F5/c1-2-9(13,14)5-3-6(10)8(12)7(11)4-5/h3-4H,2H2,1H3
InChI key:InChIKey=BTFFABVUUDOIBO-UHFFFAOYSA-N
SMILES:C(CC)(F)(F)C1=CC(F)=C(F)C(F)=C1
Synonyms:
  • Benzene, 5-(1,1-difluoropropyl)-1,2,3-trifluoro-
  • 5-(1,1-Difluoropropyl)-1,2,3-trifluorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.