CAS 1138445-63-2

2-Bromo-N-[4-[[methyl(phenylmethyl)amino]sulfonyl]phenyl]acetamide

Description:

2-Bromo-N-[4-[[methyl(phenylmethyl)amino]sulfonyl]phenyl]acetamide, with CAS number 1138445-63-2, is a synthetic organic compound characterized by its complex structure, which includes a bromine atom, an acetamide functional group, and a sulfonamide moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The sulfonamide group may contribute to its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the phenyl and methyl groups suggests that it may have lipophilic characteristics, influencing its interaction with biological membranes. Additionally, the compound's molecular structure may allow for specific interactions with biological targets, which could be relevant in drug design and development. Overall, this compound's unique features make it a subject of interest for further research in various chemical and biological applications.

Formula: C₁₆H₁₇BrN₂O₃S

InChI: InChI=1S/C16H17BrN2O3S/c1-19(12-13-5-3-2-4-6-13)23(21,22)15-9-7-14(8-10-15)18-16(20)11-17/h2-10H,11-12H2,1H3,(H,18,20)

InChI key: InChIKey=GAUNBRXAYXVGIB-UHFFFAOYSA-N

SMILES: S(N(CC1=CC=CC=C1)C)(=O)(=O)C2=CC=C(NC(CBr)=O)C=C2

Synonyms:

• Acetamide, 2-bromo-N-[4-[[methyl(phenylmethyl)amino]sulfonyl]phenyl]-
• 2-Bromo-N-[4-[[methyl(phenylmethyl)amino]sulfonyl]phenyl]acetamide