CAS 1138445-65-4

N-[4-[(2-Bromoacetyl)amino]phenyl]-N-methylacetamide

Description:

N-[4-[(2-Bromoacetyl)amino]phenyl]-N-methylacetamide is a chemical compound characterized by its amide functional group and a bromoacetyl substituent. This compound features a phenyl ring substituted with an amino group, which is further connected to a bromoacetyl moiety, indicating potential reactivity due to the presence of the bromine atom. The N-methyl group suggests that the nitrogen atom is bonded to a methyl group, which can influence the compound's solubility and biological activity. The presence of both the bromo and acetyl groups may impart unique properties, such as increased lipophilicity or specific interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a bioactive molecule. Its structural features suggest it could participate in various chemical reactions, including nucleophilic substitutions or acylation reactions, making it a versatile candidate for further research and application in drug design or synthesis.

Formula: C₁₁H₁₃BrN₂O₂

InChI: InChI=1S/C11H13BrN2O2/c1-8(15)14(2)10-5-3-9(4-6-10)13-11(16)7-12/h3-6H,7H2,1-2H3,(H,13,16)

InChI key: InChIKey=MPOMBARZZLNFIS-UHFFFAOYSA-N

SMILES: N(C(C)=O)(C)C1=CC=C(NC(CBr)=O)C=C1

Synonyms:

• Acetamide, N-[4-[(2-bromoacetyl)amino]phenyl]-N-methyl-
• N-[4-[(2-Bromoacetyl)amino]phenyl]-N-methylacetamide