
CAS 1138445-87-0
:2-Bromo-N-[4-(hexyloxy)phenyl]acetamide
Description:
2-Bromo-N-[4-(hexyloxy)phenyl]acetamide is an organic compound characterized by its unique molecular structure, which includes a bromine atom, an acetamide functional group, and a hexyloxy substituent attached to a phenyl ring. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic hexyloxy chain, while its polar acetamide group may enhance solubility in polar solvents to some extent. The presence of the bromine atom can impart specific reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular interactions can be influenced by the steric and electronic effects of the substituents, potentially affecting its pharmacokinetic properties. Overall, 2-Bromo-N-[4-(hexyloxy)phenyl]acetamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry, warranting further investigation into its properties and applications.
Formula:C14H20BrNO2
InChI:InChI=1S/C14H20BrNO2/c1-2-3-4-5-10-18-13-8-6-12(7-9-13)16-14(17)11-15/h6-9H,2-5,10-11H2,1H3,(H,16,17)
InChI key:InChIKey=KCBDDEIPZCPDAL-UHFFFAOYSA-N
SMILES:N(C(CBr)=O)C1=CC=C(OCCCCCC)C=C1
Synonyms:- 2-Bromo-N-[4-(hexyloxy)phenyl]acetamide
- Acetamide, 2-bromo-N-[4-(hexyloxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.