CymitQuimica logo

CAS 113855-03-1

:

4-Dodecyl-3-thiomorpholinone

Description:
4-Dodecyl-3-thiomorpholinone is a chemical compound characterized by its unique structure, which includes a dodecyl chain and a thiomorpholinone moiety. This compound typically exhibits properties associated with surfactants due to its long hydrophobic alkyl chain, which enhances its solubility in organic solvents while providing amphiphilic characteristics. The presence of the thiomorpholine ring contributes to its potential biological activity, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may display moderate to high stability under standard conditions, although its reactivity can vary depending on the presence of functional groups and environmental factors. Its molecular weight and specific interactions with other substances can influence its behavior in different chemical environments. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 4-Dodecyl-3-thiomorpholinone represents a versatile compound with applications in both industrial and research settings.
Formula:C16H31NOS
InChI:InChI=1S/C16H31NOS/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14-19-15-16(17)18/h2-15H2,1H3
InChI key:InChIKey=ULPYIUHHOKUHON-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)N1C(=O)CSCC1
Synonyms:
  • 4-Dodecyl-3-thiomorpholinone
  • 3-Thiomorpholinone, 4-dodecyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.