CAS 113858-90-5
:ethyl 5-cyano-6-mercapto-2-methylnicotinate
Description:
Ethyl 5-cyano-6-mercapto-2-methylnicotinate, identified by its CAS number 113858-90-5, is a chemical compound that belongs to the class of nicotinic acid derivatives. This substance features a cyano group and a mercapto group, which contribute to its reactivity and potential applications in various fields, including medicinal chemistry and organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The mercapto group may impart thiol-like properties, which can be useful in forming disulfide bonds or participating in redox reactions. Additionally, the compound's structure suggests potential biological activity, which could be explored for pharmacological applications. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. Overall, ethyl 5-cyano-6-mercapto-2-methylnicotinate represents a versatile compound with potential utility in both research and industrial applications.
Formula:C10H9N2O2S
InChI:InChI=1/C10H10N2O2S/c1-3-14-10(13)8-4-7(5-11)9(15)12-6(8)2/h4,13H,3H2,1-2H3/p-1
SMILES:CCOC(=C1C=C(C#N)C(=S)N=C1C)[O-]
Synonyms:- Ethyl 5-Cyano-2-Methyl-6-Thioxo-1,6-Dihydropyridine-3-Carboxylate
- (5-cyano-2-methyl-6-thioxopyridin-3(6H)-ylidene)(ethoxy)methanolate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
ethyl 5-cyano-6-mercapto-2-methylnicotinate
CAS:ethyl 5-cyano-6-mercapto-2-methylnicotinatePurity:≥95%Ethyl 5-cyano-2-methyl-6-sulfanylpyridine-3-carboxylate
CAS:<p>Ethyl 5-cyano-2-methyl-6-sulfanylpyridine-3-carboxylate is a carboxylic acid that belongs to the group of carboxylic acids. It has a molecular weight of 182.25 and a chemical formula of C8H7NOSO2. This compound is an ethyl ester of 5-cyano-2-methylpyridine 3,5 dicarboxylic acid, which is found in plants. The compound exhibits antibacterial activity against Streptococcus mutans, while it does not exhibit any activity against Escherichia coli or Pseudomonas aeruginosa. Ethyl 5-cyano-2-methylpyridine 3,5 dicarboxylate also exhibits antiviral properties by inhibiting the synthesis of rRNA and protein synthesis in polio virus infected cells.</p>Formula:C10H10N2O2SPurity:Min. 95%Molecular weight:222.27 g/mol


