
CAS 113866-44-7
:Brassicanal A
Description:
Brassicanal A is a chemical compound classified as a glucosinolate derivative, primarily derived from cruciferous vegetables such as broccoli and Brussels sprouts. It is known for its potential biological activities, including anti-cancer properties and the ability to modulate various cellular processes. The compound features a complex structure that includes a sulfur-containing group, which is characteristic of glucosinolates. Brassicanal A has garnered interest in the field of nutritional biochemistry due to its role in plant defense mechanisms and its potential health benefits when consumed as part of a diet rich in cruciferous vegetables. Research indicates that it may influence enzyme activity and gene expression related to detoxification and antioxidant defense. Additionally, its stability and reactivity can be affected by environmental factors, which may influence its bioavailability and efficacy in biological systems. Overall, Brassicanal A represents a significant area of study in understanding the health-promoting properties of dietary phytochemicals.
Formula:C10H9NOS
InChI:InChI=1S/C10H9NOS/c1-13-10-8(6-12)7-4-2-3-5-9(7)11-10/h2-6,11H,1H3
InChI key:InChIKey=QSSMEVWVRIEBSR-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1SC)=CC=CC2
Synonyms:- Brassicanal A
- 2-(Methylthio)-1H-indole-3-carboxaldehyde
- 2-(Methylsulfanyl)-1H-indole-3-carbaldehyde
- 1H-Indole-3-carboxaldehyde, 2-(methylthio)-
- 2-Methylsulfanyl-1H-indole-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.