CAS 113866-64-1
:α-D-Glucopyranose cyclic 2,3:4,6-bis[(1S)-4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate]
Description:
α-D-Glucopyranose cyclic 2,3:4,6-bis[(1S)-4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate] is a complex organic compound characterized by its glucopyranose backbone, which is a six-membered cyclic form of glucose. This compound features multiple hydroxyl groups, contributing to its hydrophilicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of biphenyl dicarboxylate moieties suggests that it may exhibit unique electronic properties and potential applications in materials science or medicinal chemistry. The stereochemistry indicated by the (1S) configuration implies specific spatial arrangements that can affect the compound's biological activity and interactions with other molecules. Overall, this substance is likely to be of interest in research areas such as carbohydrate chemistry, drug design, and the development of functional materials due to its structural complexity and potential for diverse applications.
Formula:C34H24O22
InChI:InChI=1S/C34H24O22/c35-10-1-6-15(23(43)19(10)39)16-7(2-11(36)20(40)24(16)44)31(48)54-27-14(5-52-30(6)47)53-34(51)29-28(27)55-32(49)8-3-12(37)21(41)25(45)17(8)18-9(33(50)56-29)4-13(38)22(42)26(18)46/h1-4,14,27-29,34-46,51H,5H2
InChI key:InChIKey=IYMHVUYNBVWXKH-UHFFFAOYSA-N
SMILES:OC1C2C(C3C(O1)COC(=O)C=4C(C=5C(C(=O)O3)=CC(O)=C(O)C5O)=C(O)C(O)=C(O)C4)OC(=O)C=6C(C=7C(C(=O)O2)=CC(O)=C(O)C7O)=C(O)C(O)=C(O)C6
Synonyms:- Dibenzo[g,i]dibenzo[6′,7′:8′,9′][1,4]dioxecino[2′,3′:4,5]pyrano[3,2-b][1,5]dioxacycloundecin, α-D-glucopyranose deriv.
- α-D-Glucopyranose cyclic 2,3:4,6-bis[(1S)-4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate]
- α-D-Glucopyranose, cyclic 2,3:4,6-bis[(1S)-4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate]
- α-D-Glucopyranose, cyclic 2,3:4,6-bis(4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate), [2(S),4(S)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pedunculagin
CAS:Pedunculagin inhibits 5α-reductase type 1, NO, IL-6, IL-8, and shows anti-inflammatory effects.Formula:C41H28O26Color and Shape:SolidMolecular weight:936.65

