CymitQuimica logo

CAS 113872-16-5

:

1H-Imidazole-4-propanoic acid, hydrazide (9CI)

Description:
1H-Imidazole-4-propanoic acid, hydrazide (9CI) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a propanoic acid moiety linked to a hydrazide functional group, contributing to its potential reactivity and biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for many hydrazides. The presence of the imidazole ring suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or antifungal agents, due to the biological significance of imidazole derivatives. Additionally, the hydrazide functionality may allow for further derivatization, enhancing its utility in various chemical reactions. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 1H-Imidazole-4-propanoic acid, hydrazide (9CI) represents a versatile compound with implications in medicinal chemistry and research.
Formula:C6H10N4O
InChI:InChI=1/C6H10N4O/c7-10-6(11)2-1-5-3-8-4-9-5/h3-4H,1-2,7H2,(H,8,9)(H,10,11)
SMILES:C(CC(=NN)O)c1cnc[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.