CymitQuimica logo

CAS 113880-83-4

:

2,4,5,6,7,8-Hexahydrocyclohepta[c]pyrrole

Description:
2,4,5,6,7,8-Hexahydrocyclohepta[c]pyrrole, identified by its CAS number 113880-83-4, is a bicyclic organic compound characterized by a nitrogen-containing heterocyclic structure. This compound features a cycloheptane ring fused with a pyrrole ring, resulting in a saturated framework that contributes to its unique chemical properties. Typically, such compounds exhibit moderate to low polarity, influencing their solubility in various solvents. The presence of nitrogen in the ring structure can impart basicity and potential reactivity in certain chemical environments. Additionally, the compound may participate in various chemical reactions, including electrophilic and nucleophilic substitutions, due to the electron-rich nature of the nitrogen atom. Its structural complexity may also lead to interesting stereochemical properties, affecting its interactions in biological systems. While specific applications may vary, compounds of this type are often explored in medicinal chemistry and materials science for their potential biological activity and utility in synthesizing more complex molecular architectures.
Formula:C9H13N
InChI:InChI=1S/C9H13N/c1-2-4-8-6-10-7-9(8)5-3-1/h6-7,10H,1-5H2
InChI key:InChIKey=IQRZMDROUZXKPN-UHFFFAOYSA-N
SMILES:C=12C(=CNC1)CCCCC2
Synonyms:
  • Cyclohepta[c]pyrrole, 2,4,5,6,7,8-hexahydro-
  • 2,4,5,6,7,8-Hexahydrocyclohepta[c]pyrrole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.