
CAS 113881-68-8
:[[1-Methylene-2-(phenylsulfonyl)propyl]thio]benzene
Description:
[[1-Methylene-2-(phenylsulfonyl)propyl]thio]benzene, with the CAS number 113881-68-8, is a chemical compound characterized by its unique structure that includes a thioether functional group and a phenylsulfonyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the phenylsulfonyl group suggests that it may engage in electrophilic aromatic substitution reactions, while the thioether linkage can influence its solubility and interaction with other chemical species. Additionally, the methylene group in the structure may provide flexibility, allowing for various conformations. Such compounds are often of interest in organic synthesis and medicinal chemistry due to their potential biological activity and utility as intermediates in the synthesis of more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for detailed applications and handling considerations.
Formula:C16H16O2S2
InChI:InChI=1S/C16H16O2S2/c1-13(19-15-9-5-3-6-10-15)14(2)20(17,18)16-11-7-4-8-12-16/h3-12,14H,1H2,2H3
InChI key:InChIKey=ULZGSAKKZIDDKK-UHFFFAOYSA-N
SMILES:S(C(C(SC1=CC=CC=C1)=C)C)(=O)(=O)C2=CC=CC=C2
Synonyms:- Benzene, [[1-methylene-2-(phenylsulfonyl)propyl]thio]-
- [[1-Methylene-2-(phenylsulfonyl)propyl]thio]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzene, [[1-methylene-2-(phenylsulfonyl)propyl]thio]-
CAS:Formula:C16H16O2S2Molecular weight:304.427
