
CAS 113882-49-8
:2(1H)-Pyridinethione, 1-[(1-oxo-4-pentenyl)oxy]-
Description:
2(1H)-Pyridinethione, 1-[(1-oxo-4-pentenyl)oxy]- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the 1-[(1-oxo-4-pentenyl)oxy]- substituent suggests that it has an ether linkage, which can influence its solubility and interaction with other molecules. The compound may exhibit various properties such as antimicrobial or antifungal activity, typical of thione derivatives, and its unique structure may allow for specific interactions in biological systems. Additionally, the presence of the unsaturated carbon chain (4-pentenyl) could provide sites for further chemical reactions, making it a candidate for various synthetic applications. Overall, this compound's characteristics make it of interest in fields such as medicinal chemistry and materials science.
Formula:C10H11NO2S
InChI:InChI=1S/C10H11NO2S/c1-2-3-7-10(12)13-11-8-5-4-6-9(11)14/h2,4-6,8H,1,3,7H2
InChI key:InChIKey=FGGXVWWGCQBJKP-UHFFFAOYSA-N
SMILES:O(C(CCC=C)=O)N1C(=S)C=CC=C1
Synonyms:- 2(1H)-Pyridinethione, 1-[(1-oxo-4-pentenyl)oxy]-
- (2-Sulfanylidenepyridin-1-yl) pent-4-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2(1H)-Pyridinethione, 1-[(1-oxo-4-pentenyl)oxy]- (9CI)
CAS:Formula:C10H11NO2SMolecular weight:209.2648
