
CAS 113884-76-7
:6,7-Isoquinolinediol, hydrobromide (1:1)
Description:
6,7-Isoquinolinediol, hydrobromide (1:1) is a chemical compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. The presence of hydroxyl groups at the 6 and 7 positions contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. The compound may exhibit biological activity, making it of interest in pharmacological research. Its molecular interactions can be influenced by the functional groups present, which may affect its reactivity and binding properties. Additionally, the hydrobromide form can stabilize the compound, facilitating its handling and storage. Safety data should be consulted for proper handling, as with any chemical substance, to mitigate risks associated with exposure. Overall, 6,7-Isoquinolinediol, hydrobromide (1:1) represents a significant compound in the realm of organic and medicinal chemistry.
Formula:C9H7NO2·BrH
InChI:InChI=1S/C9H7NO2.BrH/c11-8-3-6-1-2-10-5-7(6)4-9(8)12;/h1-5,11-12H;1H
InChI key:InChIKey=OFRUFXYUVKMBPR-UHFFFAOYSA-N
SMILES:OC1=CC2=C(C=C1O)C=NC=C2.Br
Synonyms:- 6,7-Isoquinolinediol, hydrobromide
- 6,7-Dihydroxyisoquinoline hydrobromide
- 6,7-Isoquinolinediol, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
