CAS 113890-34-9
:2-Deoxy-alpha-L-erythro-pentopyranose
Description:
2-Deoxy-alpha-L-erythro-pentopyranose is a monosaccharide, specifically a deoxysugar, which is a derivative of the pentose sugar ribose. Its structure features a five-membered pyranose ring, with a hydroxyl group replaced by a hydrogen atom at the second carbon position, hence the name "2-deoxy." This modification alters its reactivity and biological functions compared to ribose. The compound is typically found in various biological systems, particularly in nucleic acids and certain polysaccharides. It plays a crucial role in the structure of nucleotides, which are the building blocks of RNA and DNA. The stereochemistry of the molecule is significant, as it influences its interactions with enzymes and other biomolecules. In terms of physical properties, 2-deoxy-alpha-L-erythro-pentopyranose is generally a white crystalline solid, soluble in water, and exhibits typical behavior of sugars, such as participating in glycosidic bond formation. Its CAS number, 113890-34-9, is a unique identifier that facilitates its identification in chemical databases and literature.
Formula:C5H10O4
InChI:InChI=1/C5H10O4/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2/t3-,4+,5-/m1/s1
Synonyms:- A-L-Erythro-Pentopyranose,2-Deoxy-
- 2-Deoxy-a-L-erythro pentopyranose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
