CAS 113890-38-3
:2-Deoxy-beta-L-erythro-pentofuranose
Description:
2-Deoxy-beta-L-erythro-pentofuranose is a sugar derivative characterized by its five-membered furanose ring structure, which is a common feature in many carbohydrates. This compound is a deoxysugar, meaning it lacks one oxygen atom compared to its parent sugar, ribose. Specifically, it is a 2-deoxy sugar, indicating that the hydroxyl group at the second carbon is replaced by a hydrogen atom. The beta configuration refers to the orientation of the hydroxyl group on the anomeric carbon, which is positioned above the plane of the ring in the Haworth projection. This compound plays a significant role in biochemistry, particularly in the structure of nucleotides and nucleic acids, where it is a component of certain RNA analogs. Its unique structural features contribute to its biological functions and interactions. Additionally, 2-Deoxy-beta-L-erythro-pentofuranose can be involved in various metabolic pathways and is of interest in medicinal chemistry for its potential applications in drug design and development.
Formula:C5H10O4
InChI:InChI=1/C5H10O4/c6-2-4-3(7)1-5(8)9-4/h3-8H,1-2H2/t3-,4+,5+/m1/s1
Synonyms:- 2-Deoxy-β-L-erythro-pentofuranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Deoxy-b-L-erythro-pentofuranose
CAS:<p>2-Deoxy-b-L-erythro-pentofuranose is an experimental drug that is a protonation product of 2,3-dideoxyproline. It is the result of conformational changes in the deoxyribose ring and puckering of the ribose units. The puckering motion also results in a change in the orientation of the hydrogen atoms on the carbons. This has led to analogous carbon configurations with different numbers of hydrogens, which can lead to different solutions. 2-Deoxy-b-L-erythro-pentofuranose binds to ribosomes and inhibits protein synthesis, which may be due to its pyrrolidine ring or membered ring structure.</p>Formula:C5H10O4Purity:Min. 95%Molecular weight:134.13 g/molRef: 4Z-B-087037
Discontinued product
