CAS 113899-55-1

2-bromo-α-methylBenzenemethanamine

Description:

2-Bromo-α-methylbenzenemethanamine, also known as 2-bromo-α-methylphenethylamine, is an organic compound characterized by the presence of a bromine atom and an amino group attached to a phenethylamine structure. This compound features a bromine substituent at the second position of the aromatic ring, while the α-methyl group contributes to its unique steric and electronic properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group suggests that it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the bromine atom can serve as a leaving group in synthetic applications. Due to its structural features, this compound may have potential applications in medicinal chemistry and as an intermediate in the synthesis of other organic compounds. However, safety and handling precautions should be observed, as with many halogenated amines, due to potential toxicity and reactivity.

Formula: C₈H₁₀BrN

InChI: InChI=1S/C8H10BrN/c1-6(10)7-4-2-3-5-8(7)9/h2-6H,10H2,1H3

SMILES: CC(c1ccccc1Br)N

Synonyms:

• 1-(2'-Bromophenyl)Ethylamine
• 1-(2-Bromophenyl)Ethanamine
• Benzenemethanamine, 2-bromo-.alpha.-methyl-
• 2-Bromo-alpha-methylbenzenemethanamine
• Benzenemethanamine, 2-bromo-α-methyl-
• 2-bromo-α-methylBenzenemethanamine

Benzenemethanamine, 2-bromo-α-methyl-

CAS: 113899-55-1

Formula: C₈H₁₀BrN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 200.0757

Ref: IN-DA000A0W

1-(2-Bromophenyl)ethan-1-amine

CAS: 113899-55-1

1-(2-Bromophenyl)ethan-1-amine

Purity: 98%

Molecular weight: 200.08g/mol

Ref: 54-OR94500

1-(2-Bromophenyl)ethylamine

CAS: 113899-55-1

Formula: C₈H₁₀BrN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 200.079

Ref: 10-F048823