CAS 1139-34-0
:1,3-Dihydro-3-hydroxy-3-[2-(hydroxyimino)propyl]-2H-indol-2-one
Description:
1,3-Dihydro-3-hydroxy-3-[2-(hydroxyimino)propyl]-2H-indol-2-one, with CAS number 1139-34-0, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a hydroxyl group and a hydroxyimino group, contributing to its potential reactivity and biological activity. The presence of these functional groups suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can influence its solubility and stability. The compound is of interest in various fields, including medicinal chemistry, due to its potential pharmacological properties. Its structural features may allow it to interact with biological targets, making it a candidate for further research in drug development. Additionally, the indole framework is known for its occurrence in many natural products and pharmaceuticals, highlighting the relevance of this compound in synthetic and medicinal chemistry contexts.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c1-7(13-16)6-11(15)8-4-2-3-5-9(8)12-10(11)14/h2-5,15-16H,6H2,1H3,(H,12,14)
InChI key:InChIKey=FMSUHJDSPXJLBK-UHFFFAOYSA-N
SMILES:C(C(=NO)C)C1(O)C=2C(NC1=O)=CC=CC2
Synonyms:- 1,3-Dihydro-3-hydroxy-3-[2-(hydroxyimino)propyl]-2H-indol-2-one
- 3-Hydroxy-3-(2-hydroxyimino-propyl)-1,3-dihydro-indol-2-one
- NSC 148490
- 2-Indolinone, 3-acetonyl-3-hydroxy-, 3-oxime
- 2H-Indol-2-one, 1,3-dihydro-3-hydroxy-3-[2-(hydroxyimino)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
