CAS 1139-52-2
:4-Bromo-2,6-di-tert-butylphenol
Description:
4-Bromo-2,6-di-tert-butylphenol is an organic compound characterized by its phenolic structure, which includes a bromine atom and two tert-butyl groups attached to the aromatic ring. This compound is typically a white to light yellow solid at room temperature and is known for its antioxidant properties, making it useful in various industrial applications, particularly in plastics and rubber. The presence of the bulky tert-butyl groups enhances its stability and solubility in organic solvents while providing steric hindrance that can influence its reactivity. The bromine substituent can also participate in further chemical reactions, such as nucleophilic substitutions. In terms of safety, like many phenolic compounds, it may pose health risks if ingested or inhaled, necessitating appropriate handling precautions. Its chemical formula reflects its molecular structure, and it is often analyzed using techniques such as NMR and mass spectrometry to confirm its identity and purity. Overall, 4-Bromo-2,6-di-tert-butylphenol is a significant compound in materials science and organic chemistry.
Formula:C14H21BrO
InChI:InChI=1S/C14H21BrO/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,16H,1-6H3
InChI key:InChIKey=SSQQUEKFNSJLKX-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(O)C(C(C)(C)C)=CC(Br)=C1
Synonyms:- 2,6-Di-tert-butyl-4-bromophenol
- 4-Bromo-2,6-bis(1,1-dimethylethyl)phenol
- 4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol
- 4-Hydroxy-3,5-di(tert-butyl)bromobenzene
- NSC 169952
- NSC 98406
- Phenol, 4-Bromo-2,6-Bis(1,1-Dimethylethyl)-
- Phenol, 4-bromo-2,6-di-tert-butyl-
- 4-Bromo-2,6-di-tert-butylphenol
- 4-Bromo-2,6-di-tert-butylphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Bromo-2,6-di-tert-butylphenol
CAS:Formula:C14H21BrOPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:285.23Phenol, 4-bromo-2,6-bis(1,1-dimethylethyl)-
CAS:Formula:C14H21BrOPurity:97%Color and Shape:SolidMolecular weight:285.21992,6-Bis(tert-butyl)-4-bromophenol
CAS:2,6-Bis(tert-butyl)-4-bromophenolFormula:C14H21BrOPurity:98%Color and Shape: light yellow. crystalline solidMolecular weight:285.22g/mol4-Bromo-2,6-di-tert-butylphenol
CAS:4-Bromo-2,6-di-tert-butylphenol is a chemical compound. It is a yellow solid with an optical rotation of +42.8° (c=0.5, methanol). The molecular weight is 270.4 g/mol and the density is 1.06 g/cm3. The chemical formula is C11H14Br2O4. This compound can be prepared from 2,6-di-tert-butylbenzaldehyde by reaction with bromine in the presence of alkali or from 4,4′-biphenol by reaction with bromine in the presence of sodium hydroxide in ethanol. The compound exists as two enantiomers: R-(+)-4-Bromo-2,6-di-tert-butylphenol and S-(-)4-Bromo-2,6,-di tert butylphenol. Optical activityFormula:C14H21BrOPurity:Min. 95%Color and Shape:PowderMolecular weight:285.22 g/mol4-Bromo-2,6-di-tert-butylphenol
CAS:BR1061 - 4-Bromo-2,6-di-tert-butylphenol
Formula:C14H21BrOPurity:95%Color and Shape:SolidMolecular weight:285.225




