
CAS 113900-63-3
:Carbamothioic acid, [(1-methoxy-1H-indol-3-yl)methyl]-, S-methyl ester
Description:
Carbamothioic acid, [(1-methoxy-1H-indol-3-yl)methyl]-, S-methyl ester, identified by CAS number 113900-63-3, is a chemical compound characterized by its unique structure that combines an indole moiety with a carbamothioic acid derivative. This compound features a methoxy group attached to the indole ring, which contributes to its potential biological activity and solubility properties. The presence of the S-methyl ester functional group indicates that it may exhibit specific reactivity patterns typical of thioesters, such as susceptibility to nucleophilic attack. The compound's indole structure is known for its role in various biological processes and can influence its pharmacological properties. Additionally, the presence of the carbamothioic acid functionality suggests potential applications in medicinal chemistry, particularly in the development of compounds with antimicrobial or anticancer activities. Overall, this compound's unique structural features may provide avenues for research in organic synthesis and drug development, although specific biological activities and applications would require further investigation.
Formula:C12H14N2O2S
InChI:InChI=1S/C12H14N2O2S/c1-16-14-8-9(7-13-12(15)17-2)10-5-3-4-6-11(10)14/h3-6,8H,7H2,1-2H3,(H,13,15)
InChI key:InChIKey=BHXCFNZULGNWRA-UHFFFAOYSA-N
SMILES:C(NC(SC)=O)C=1C=2C(N(OC)C1)=CC=CC2
Synonyms:- 1-Methoxybrassitin
- Carbamothioic acid, [(1-methoxy-1H-indol-3-yl)methyl]-, S-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S-Methyl ((1-methoxy-1H-indol-3-yl)methyl)carbamothioate
CAS:Formula:C12H14N2O2SMolecular weight:250.3168
