CAS 113913-36-3
:2-Methyl-4-Hydroxy-2H-1,2-Benzothiazine-3-Carboxylic Acid Ethyl Ester 1,1-Dioxide
Description:
2-Methyl-4-Hydroxy-2H-1,2-Benzothiazine-3-Carboxylic Acid Ethyl Ester 1,1-Dioxide, with CAS number 113913-36-3, is a chemical compound characterized by its unique benzothiazine structure, which incorporates both hydroxyl and carboxylic acid functional groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid moiety. The ethyl ester group enhances its lipophilicity, which may influence its biological activity and pharmacokinetics. The presence of the hydroxyl group can contribute to hydrogen bonding, affecting its interaction with other molecules. This compound may be of interest in medicinal chemistry, particularly for its potential therapeutic applications, as benzothiazine derivatives are often explored for their biological activities, including anti-inflammatory and analgesic properties. However, specific characteristics such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise values.
Formula:C12H13NO5S
InChI:InChI=1/C12H13NO5S/c1-3-18-12(15)10-11(14)8-6-4-5-7-9(8)19(16,17)13(10)2/h4-7,14H,3H2,1-2H3
SMILES:CCOC(=O)C1=C(c2ccccc2S(=O)(=O)N1C)O
Synonyms:- ethyl 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylate 1,1-dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2H-1,2-Benzothiazine-3-carboxylic acid, 3,4-dihydro-4-hydroxy-2-methyl-, ethyl ester, 1,1-dioxide
CAS:Formula:C12H15NO5SColor and Shape:SolidMolecular weight:285.31623,4-Dihydro-4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid ethyl ester 1,1-dioxide
CAS:<p>3,4-Dihydro-4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid ethyl ester 1,1-dioxide is a synthetic sulfoxide that is used as an antiinflammatory drug. It is a stable compound that can be used in the production of dimethyl sulfoxide and piroxicam. The purity of this compound is greater than 99.5%.</p>Formula:C12H13NO5SPurity:Min. 95%Molecular weight:283.3 g/mol

