CymitQuimica logo

CAS 113915-64-3

:

4-[4-(Diethylamino)phenyl]-4-(4-methoxyphenyl)-N,N,6-trimethyl-2-phenyl-4H-3,1-benzoxazin-7-amine

Description:
The chemical substance known as 4-[4-(Diethylamino)phenyl]-4-(4-methoxyphenyl)-N,N,6-trimethyl-2-phenyl-4H-3,1-benzoxazin-7-amine, with the CAS number 113915-64-3, is a complex organic compound characterized by its multi-functional aromatic structure. It features a benzoxazine core, which is notable for its potential applications in materials science and medicinal chemistry. The presence of diethylamino and methoxy groups contributes to its electronic properties, potentially enhancing its solubility and reactivity. This compound may exhibit interesting photophysical properties, making it a candidate for use in dyes or fluorescent materials. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which could influence its behavior in solid-state applications. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed through various analytical methods. Overall, this compound represents a class of materials with diverse applications in both research and industry.
Formula:C34H37N3O2
InChI:InChI=1S/C34H37N3O2/c1-7-37(8-2)28-18-14-26(15-19-28)34(27-16-20-29(38-6)21-17-27)30-22-24(3)32(36(4)5)23-31(30)35-33(39-34)25-12-10-9-11-13-25/h9-23H,7-8H2,1-6H3
InChI key:InChIKey=OBIHCWVSAKSGKY-UHFFFAOYSA-N
SMILES:CC=1C=C2C(OC(=NC2=CC1N(C)C)C3=CC=CC=C3)(C4=CC=C(N(CC)CC)C=C4)C5=CC=C(OC)C=C5
Synonyms:
  • 4-[4-(Diethylamino)phenyl]-4-(4-methoxyphenyl)-N,N,6-trimethyl-2-phenyl-4H-3,1-benzoxazin-7-amine
  • 4H-3,1-Benzoxazin-7-amine, 4-[4-(diethylamino)phenyl]-4-(4-methoxyphenyl)-N,N,6-trimethyl-2-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.