CymitQuimica logo

CAS 113934-26-2

:

1-(4-Nitrophenyl)-1H-1,2,3-triazole-4-carboxaldehyde

Description:
1-(4-Nitrophenyl)-1H-1,2,3-triazole-4-carboxaldehyde is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a nitrophenyl group, which contributes to its electronic properties and potential reactivity. The presence of a carboxaldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The nitro group on the phenyl ring enhances the compound's electrophilicity, making it useful in synthetic organic chemistry. Additionally, the triazole moiety is known for its applications in pharmaceuticals and agrochemicals due to its biological activity. The compound may exhibit properties such as fluorescence or photostability, depending on its molecular structure and environment. Its solubility and stability can vary based on the solvent and conditions used. Overall, 1-(4-Nitrophenyl)-1H-1,2,3-triazole-4-carboxaldehyde is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C9H6N4O3
InChI:InChI=1S/C9H6N4O3/c14-6-7-5-12(11-10-7)8-1-3-9(4-2-8)13(15)16/h1-6H
InChI key:InChIKey=YGHWZZLJKCSTCA-UHFFFAOYSA-N
SMILES:C(=O)C1=CN(N=N1)C2=CC=C(N(=O)=O)C=C2
Synonyms:
  • 1H-1,2,3-Triazole-4-carboxaldehyde, 1-(4-nitrophenyl)-
  • 1-(4-Nitrophenyl)triazole-4-carbaldehyde
  • 1-(4-Nitrophenyl)-1H-1,2,3-triazole-4-carboxaldehyde
  • 1-(4-Nitrophenyl)-1H-1,2,3-triazole-4-carbaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.