CAS 113934-33-1

Formula: C10H6F3N3O2

InChI: InChI=1S/C10H6F3N3O2/c11-10(12,13)6-2-1-3-7(4-6)16-5-8(9(17)18)14-15-16/h1-5H,(H,17,18)

InChI key: BWGYSLOUFDNBHC-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)N2C=C(N=N2)C(=O)O)C(F)(F)F

1-[3-(Trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxylic acid

CAS: 113934-33-1

1-[3-(Trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxylic acid (TFTCA) is a versatile building block used as a reagent in research and speciality chemical synthesis. TFTCA is used as a reactant in the synthesis of complex compounds and can be used as an intermediate or scaffold. The compound has been used to synthesize drugs such as 3,5-dichloro-N-(3-(trifluoromethyl)phenyl)-2-thiophenecarboxamide (PF23410), which is a potent inhibitor of protein kinase C.

Formula: C₁₀H₆F₃N₃O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 257.17 g/mol

Ref: 3D-NEA93433