CymitQuimica logo

CAS 113940-14-0

:

5-(Chloromethyl)-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide

Description:
5-(Chloromethyl)-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a carboxamide functional group, and a chloromethyl substituent. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are known for their diverse pharmacological properties. The chloromethyl group can serve as a reactive site for further chemical modifications, enhancing its utility in synthetic chemistry. Additionally, the N-(4-methylphenyl) substituent introduces aromatic characteristics, which may influence the compound's solubility and interaction with biological targets. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is synthesized and tested. As with many chemical substances, safety and handling precautions are essential due to the presence of chlorine and potential toxicity associated with the thiadiazole framework.
Formula:C11H10ClN3OS
InChI:InChI=1S/C11H10ClN3OS/c1-7-2-4-8(5-3-7)13-10(16)11-15-14-9(6-12)17-11/h2-5H,6H2,1H3,(H,13,16)
InChI key:InChIKey=ILVZAUZSRSHHSM-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C)C=C1)(=O)C=2SC(CCl)=NN2
Synonyms:
  • 1,3,4-Thiadiazole-2-carboxamide, 5-(chloromethyl)-N-(4-methylphenyl)-
  • 5-(Chloromethyl)-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.