CAS 113947-86-7

1-(3-methylbut-3-enyl)-4-(trifluoromethyl)benzene

Description:

1-(3-methylbut-3-enyl)-4-(trifluoromethyl)benzene, also known by its CAS number 113947-86-7, is an organic compound characterized by a benzene ring substituted with a trifluoromethyl group and a branched alkenyl group. The presence of the trifluoromethyl group (-CF3) imparts unique electronic and steric properties, enhancing the compound's lipophilicity and potentially influencing its reactivity and interactions in various chemical environments. The alkenyl substituent, derived from 3-methylbut-3-ene, introduces a degree of unsaturation, which can participate in addition reactions or polymerization processes. This compound may exhibit interesting physical properties, such as volatility and solubility, influenced by the balance between the hydrophobic aromatic system and the polar trifluoromethyl group. Its structural features suggest potential applications in materials science, pharmaceuticals, or as an intermediate in organic synthesis. However, specific reactivity and stability would depend on the conditions under which it is used, including temperature, solvent, and the presence of catalysts or other reagents.

Formula: C₁₂H₁₃F₃

InChI: InChI=1/C12H13F3/c1-9(2)3-4-10-5-7-11(8-6-10)12(13,14)15/h5-8H,1,3-4H2,2H3

SMILES: C=C(C)CCc1ccc(cc1)C(F)(F)F