CAS 113947-87-8

1-(3-methylbut-3-enyl)-3-(trifluoromethyl)benzene

Description:

1-(3-Methylbut-3-enyl)-3-(trifluoromethyl)benzene, identified by its CAS number 113947-87-8, is an organic compound characterized by its unique structural features. It consists of a benzene ring substituted with a trifluoromethyl group and a 3-methylbut-3-enyl group. The presence of the trifluoromethyl group imparts significant electronegativity and lipophilicity, influencing the compound's reactivity and solubility properties. The 3-methylbut-3-enyl substituent introduces a degree of unsaturation, which can affect the compound's stability and potential for undergoing reactions such as polymerization or electrophilic aromatic substitution. This compound may exhibit interesting physical properties, including volatility and specific boiling and melting points, which are typical for aromatic compounds. Additionally, its unique structure may confer specific biological activities or applications in fields such as pharmaceuticals, agrochemicals, or materials science. However, detailed safety and handling information should be consulted, as the trifluoromethyl group can also pose environmental and health risks.

Formula: C₁₂H₁₃F₃

InChI: InChI=1/C12H13F3/c1-9(2)6-7-10-4-3-5-11(8-10)12(13,14)15/h3-5,8H,1,6-7H2,2H3

SMILES: C=C(C)CCc1cccc(c1)C(F)(F)F